Products 714950-53-5
CAS 714950-53-5 appears in our catalog under these names: Adenosine-3'-13C, 98% 98%atom%13C, Adenosine-3'-13C, Adenosine-3′-13C. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)(413C)oxolane-3,4-diol (CAS 714950-53-5) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 268.23 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)(413C)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-JUUGEQNTSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)(413C)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-JUUGEQNTSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([13C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)