CAS 41547-82-4 appears in our catalog under these names: Adenosine-15N, 98% 98%atom%15N, Adenosine-15N, >95% (HPLC), Adenosine-15N. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 5mg, 50 mg, 25 mg, 5 mg.
(2R,3R,4S,5R)-2-(6-(15N)azanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 41547-82-4) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 268.23 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-(15N)azanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-ZGUONDJVSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-(15N)azanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-ZGUONDJVSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)[15NH2] |
Computed by PubChem (NCBI)