Products 159663-16-8
CAS 159663-16-8 appears in our catalog under these names: L–Glutamine–1–13C, L-Glutamine-1-13C, 98%, 98%, L-Glutamine-1-13C, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10 mg, 1 mg, 5 mg.
(2S)-2,5-diamino-5-oxo(113C)pentanoic acid (CAS 159663-16-8) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-2,5-diamino-5-oxo(113C)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-YTCQKPCCSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-2,5-diamino-5-oxo(113C)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-YTCQKPCCSA-N |
| SMILES | C(CC(=O)N)[C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)