CAS 1596745-50-4 is the registry number for 2-Bromo-5,7-dichloroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,7-dichloroquinoline (CAS 1596745-50-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 2-bromo-5,7-dichloroquinoline. InChIKey: VRVDNGYRNLRMEB-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 2-bromo-5,7-dichloroquinoline |
| InChIKey | VRVDNGYRNLRMEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CC(=C2)Cl)Cl)Br |
Computed by PubChem (NCBI)