CAS 406204-86-2 appears in our catalog under these names: 8-Bromo-2,4-dichloroquinoline, 95%, 8-Bromo-2,4-dichloroquinoline, 8-Bromo-2,4-dichloroquinoline, 97%, 97%, 8-Bromo-2,4-dichloroquinoline, 98%, 8-Bromo-2,4-dichloroquinoline, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg, 10g.
8-bromo-2,4-dichloroquinoline (CAS 406204-86-2) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 8-bromo-2,4-dichloroquinoline. InChIKey: RRMPRAHNBHWFCZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 8-bromo-2,4-dichloroquinoline |
| InChIKey | RRMPRAHNBHWFCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)