CAS 552331-05-2 appears in our catalog under these names: 6-Bromo-1,3-dichloroisoquinoline, 97%, 6-Bromo-1,3-dichloroisoquinoline 97%, 6-Bromo-1,3-dichloroisoquinoline, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 100g, 10g.
6-bromo-1,3-dichloroisoquinoline (CAS 552331-05-2) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 6-bromo-1,3-dichloroisoquinoline. InChIKey: YRSSIZNHQQNESH-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 6-bromo-1,3-dichloroisoquinoline |
| InChIKey | YRSSIZNHQQNESH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)