CAS 1598437-05-8 appears in our catalog under these names: (2-(2-Hydroxypropan-2-yl)pyrimidin-5-yl)boronic acid, 97%, (2–(2–hydroxypropan–2–yl)pyrimidin–5–yl)boronic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 25mg, 5mg.
[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid (CAS 1598437-05-8) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 181.99 g/mol. IUPAC name: [2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid. InChIKey: PZRBDMOYZYHVGV-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 181.99 g/mol |
| IUPAC name | [2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | PZRBDMOYZYHVGV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C(C)(C)O)(O)O |
Computed by PubChem (NCBI)