CAS 1678532-61-0 appears in our catalog under these names: Boronic acid, b-[1-(tetrahydro-3-furanyl)-1h-pyrazol-4-yl]-, 95%, (1-(Tetrahydrofuran-3-yl)-1H-pyrazol-4-yl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[1-(oxolan-3-yl)pyrazol-4-yl]boronic acid (CAS 1678532-61-0) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 181.99 g/mol. IUPAC name: [1-(oxolan-3-yl)pyrazol-4-yl]boronic acid. InChIKey: KNDRKBDRSLTBPA-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 181.99 g/mol |
| IUPAC name | [1-(oxolan-3-yl)pyrazol-4-yl]boronic acid |
| InChIKey | KNDRKBDRSLTBPA-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2CCOC2)(O)O |
Computed by PubChem (NCBI)