CAS 2225176-43-0 is the registry number for 2–(n–Propoxy–d7)–pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,2,2,3,3,3-heptadeuteriopropoxy)pyrimidin-5-yl]boronic acid (CAS 2225176-43-0) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 189.03 g/mol. IUPAC name: [2-(1,1,2,2,3,3,3-heptadeuteriopropoxy)pyrimidin-5-yl]boronic acid. InChIKey: ZLKBIZWGWWVVJF-NCKGIQLSSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 189.03 g/mol |
| IUPAC name | [2-(1,1,2,2,3,3,3-heptadeuteriopropoxy)pyrimidin-5-yl]boronic acid |
| InChIKey | ZLKBIZWGWWVVJF-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])OC1=NC=C(C=N1)B(O)O |
Computed by PubChem (NCBI)