CAS 2225170-78-3 is the registry number for 2–Hydroxy–4–(iso–propyl)pyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-oxo-6-propan-2-yl-1H-pyrimidin-5-yl)boronic acid (CAS 2225170-78-3) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 181.99 g/mol. IUPAC name: (2-oxo-6-propan-2-yl-1H-pyrimidin-5-yl)boronic acid. InChIKey: CCJADNHBGKQGIZ-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 181.99 g/mol |
| IUPAC name | (2-oxo-6-propan-2-yl-1H-pyrimidin-5-yl)boronic acid |
| InChIKey | CCJADNHBGKQGIZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(NC(=O)N=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)