CAS 2241877-08-5 is the registry number for (2–(2–hydroxypropan–2–yl–1,1,1,3,3,3–d6)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid (CAS 2241877-08-5) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 188.02 g/mol. IUPAC name: [2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid. InChIKey: PZRBDMOYZYHVGV-WFGJKAKNSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | [2-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | PZRBDMOYZYHVGV-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=NC=C(C=N1)B(O)O)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)