Products 2241877-12-1
CAS 2241877-12-1 is the registry number for (2–(ethoxy–d5)–4–(methyl–d3)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,2,2,2-pentadeuterioethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid (CAS 2241877-12-1) is a chemical compound with the molecular formula C7H11BN2O3 and a molecular weight of 190.04 g/mol. IUPAC name: [2-(1,1,2,2,2-pentadeuterioethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid. InChIKey: KDOATRNGTLAUKL-AUOAYUKBSA-N.
| Molecular formula | C7H11BN2O3 |
|---|---|
| Molecular weight | 190.04 g/mol |
| IUPAC name | [2-(1,1,2,2,2-pentadeuterioethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | KDOATRNGTLAUKL-AUOAYUKBSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=NC=C1B(O)O)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)