CAS 159954-34-4 appears in our catalog under these names: 6–Chloro–3–indoxyl butyrate, 6-Chloro-3-indolyl butyrate, 6-Chloro-3-indoxyl butyrate 97%, 6-Chloro-1H-indol-3-yl butyrate, 97%, 97%, 6-Chloro-3-indoxyl butyrate. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 1g, 0,5g, 5g, 100mg, 250 mg.
(6-chloro-1H-indol-3-yl) butanoate (CAS 159954-34-4) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: (6-chloro-1H-indol-3-yl) butanoate. InChIKey: GOEDSAJOXJKQKC-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | (6-chloro-1H-indol-3-yl) butanoate |
| InChIKey | GOEDSAJOXJKQKC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
Computed by PubChem (NCBI)