Products 1600535-74-7
CAS 1600535-74-7 appears in our catalog under these names: Herniarin–d3, Herniarin-d3, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
7-(trideuteriomethoxy)chromen-2-one (CAS 1600535-74-7) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 179.19 g/mol. IUPAC name: 7-(trideuteriomethoxy)chromen-2-one. InChIKey: LIIALPBMIOVAHH-FIBGUPNXSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 7-(trideuteriomethoxy)chromen-2-one |
| InChIKey | LIIALPBMIOVAHH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=CC(=O)O2 |
Computed by PubChem (NCBI)
Synonyms:
Herniarin-d3, orb3138659