Products 1602871-83-9
CAS 1602871-83-9 appears in our catalog under these names: 1-(4-Fluoro-2-methylbenzyl)cyclopropane-1-carboxylic acid, 98%, 1-((4-Fluoro-2-methylphenyl)methyl)cyclopropane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(4-fluoro-2-methylphenyl)methyl]cyclopropane-1-carboxylic acid (CAS 1602871-83-9) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-[(4-fluoro-2-methylphenyl)methyl]cyclopropane-1-carboxylic acid. InChIKey: XOMWZAUOVHNMTN-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-[(4-fluoro-2-methylphenyl)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | XOMWZAUOVHNMTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)CC2(CC2)C(=O)O |
Computed by PubChem (NCBI)