CAS 1607-51-8 appears in our catalog under these names: 2-Amino-4-phenoxyphenol, 95%, 2-Amino-4-phenoxyphenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-amino-4-phenoxyphenol (CAS 1607-51-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-4-phenoxyphenol. InChIKey: WQYFAQXHLFJZIK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-4-phenoxyphenol |
| InChIKey | WQYFAQXHLFJZIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)O)N |
Computed by PubChem (NCBI)