Products 1609400-03-4

CAS 1609400-03-4 is the registry number for 5-Bromo-2-methylimidazo[1,2-a]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 1609400-03-4) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: CBEXFBLYOLENOU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClN2
Molecular weight247.52 g/mol
IUPAC name5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride
InChIKeyCBEXFBLYOLENOU-UHFFFAOYSA-N
SMILESCC1=CN2C(=N1)C=CC=C2Br.Cl

Computed by PubChem (NCBI)