CAS 1609400-03-4 is the registry number for 5-Bromo-2-methylimidazo[1,2-a]pyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 1609400-03-4) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: CBEXFBLYOLENOU-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 5-bromo-2-methylimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | CBEXFBLYOLENOU-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)