CAS 91481-24-2 appears in our catalog under these names: 2-Amino-2-(3-bromophenyl)acetonitrile hydrochloride, 2-Amino-2-(3-bromophenyl)acetonitrile hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-amino-2-(3-bromophenyl)acetonitrile;hydrochloride (CAS 91481-24-2) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 2-amino-2-(3-bromophenyl)acetonitrile;hydrochloride. InChIKey: BYUVTNZFZBMQMX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 2-amino-2-(3-bromophenyl)acetonitrile;hydrochloride |
| InChIKey | BYUVTNZFZBMQMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C#N)N.Cl |
Computed by PubChem (NCBI)