CAS 957120-36-4 appears in our catalog under these names: 8-Bromo-5-methylimidazo[1,2-a]pyridine hydrochloride, 98%, 8-Bromo-5-methylimidazo[1,2-a]pyridine, HCl, ≥97%, ≥97%, 8-Bromo-5-methylimidazo[1,2-a]pyridine hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
8-bromo-5-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 957120-36-4) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 8-bromo-5-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: XDXQVISKIZXMLN-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 8-bromo-5-methylimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | XDXQVISKIZXMLN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=NC=CN12)Br.Cl |
Computed by PubChem (NCBI)