CAS 1893457-72-1 is the registry number for 5-Bromo-1H-indol-3-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-1H-indol-3-amine;hydrochloride (CAS 1893457-72-1) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 5-bromo-1H-indol-3-amine;hydrochloride. InChIKey: BRGHKBZUPNOLGR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 5-bromo-1H-indol-3-amine;hydrochloride |
| InChIKey | BRGHKBZUPNOLGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)N.Cl |
Computed by PubChem (NCBI)