CAS 2306262-55-3 is the registry number for 3-Bromo-2-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine (CAS 2306262-55-3) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 3-bromo-2-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine. InChIKey: SGLHBDGSTMIONC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 3-bromo-2-chloro-5,6,7,8-tetrahydro-1,7-naphthyridine |
| InChIKey | SGLHBDGSTMIONC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=NC(=C(C=C21)Br)Cl |
Computed by PubChem (NCBI)