CAS 2684295-09-6 is the registry number for 2-(Aminomethyl)-5-bromobenzonitrile hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(aminomethyl)-5-bromobenzonitrile;hydrochloride (CAS 2684295-09-6) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 2-(aminomethyl)-5-bromobenzonitrile;hydrochloride. InChIKey: GPTCKIMINOIJJM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 2-(aminomethyl)-5-bromobenzonitrile;hydrochloride |
| InChIKey | GPTCKIMINOIJJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C#N)CN.Cl |
Computed by PubChem (NCBI)