CAS 1610-04-4 is the registry number for 2-Bromo-2,2-difluoro-1-phenylethanone, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-2,2-difluoro-1-phenylethanone (CAS 1610-04-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-2,2-difluoro-1-phenylethanone. InChIKey: QRVPSDIABPAOTN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-2,2-difluoro-1-phenylethanone |
| InChIKey | QRVPSDIABPAOTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(F)(F)Br |
Computed by PubChem (NCBI)