Products 161170-50-9

CAS 161170-50-9 is the registry number for rac-(1R,2S)-2-(Trifluoromethyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 161170-50-9) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: cis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: RAGWFGSHOZGADV-RITPCOANSA-N.

Identity
Molecular formulaC8H11F3O2
Molecular weight196.17 g/mol
IUPAC namecis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid
InChIKeyRAGWFGSHOZGADV-RITPCOANSA-N
SMILESC1CC[C@@H]([C@@H](C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)