CAS 161170-50-9 is the registry number for rac-(1R,2S)-2-(Trifluoromethyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 161170-50-9) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: cis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: RAGWFGSHOZGADV-RITPCOANSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | cis-(1R,2S)-2-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | RAGWFGSHOZGADV-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)