CAS 161176-99-4 is the registry number for 2-(2-Hydroxyethyl)-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one (CAS 161176-99-4) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one. InChIKey: SELSMKTXYUHOMK-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(2-hydroxyethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | SELSMKTXYUHOMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(O2)CCO |
Computed by PubChem (NCBI)