CAS 1613-79-2 appears in our catalog under these names: Benzamide, n-methoxy-4-nitro-, 95%, N-Methoxy-4-nitrobenzamide, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 10g, 25g.
N-methoxy-4-nitrobenzamide (CAS 1613-79-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: N-methoxy-4-nitrobenzamide. InChIKey: HIJYJXGWKHLZPA-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | N-methoxy-4-nitrobenzamide |
| InChIKey | HIJYJXGWKHLZPA-UHFFFAOYSA-N |
| SMILES | CONC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)