Products 1613289-32-9
CAS 1613289-32-9 appears in our catalog under these names: 8-Chloro-5-methylpyrido[2,3-b]pyrazin-6(5h)-one, 95%, 8-Chloro-5-methylpyrido(2,3-b)pyrazin-6(5H)-one, 97%, 8-chloro-5-methyl-5H,6H-pyrido[2,3-b]pyrazin-6-one, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
8-chloro-5-methylpyrido[2,3-b]pyrazin-6-one (CAS 1613289-32-9) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 8-chloro-5-methylpyrido[2,3-b]pyrazin-6-one. InChIKey: YFGRUGPJPJHFQF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 8-chloro-5-methylpyrido[2,3-b]pyrazin-6-one |
| InChIKey | YFGRUGPJPJHFQF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(C2=NC=CN=C21)Cl |
Computed by PubChem (NCBI)