CAS 16144-91-5 appears in our catalog under these names: 3,6-Dihydroxybenzonorbornane, 95%, 3,6–Dihydroxybenzonorbornane, 3,6-Dihydroxybenzonorbornane [Antioxidant], >98.0%(HPLC)(T), 1,2,3,4-Tetrahydro-1,4-methanonaphthalene-5,8-diol. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg.
Tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol (CAS 16144-91-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol. InChIKey: JYHNNCBQCSLFQM-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3,6-diol |
| InChIKey | JYHNNCBQCSLFQM-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C3=C(C=CC(=C23)O)O |
Computed by PubChem (NCBI)