CAS 1620412-64-7 is the registry number for Methyl 4-amino-2,3-dihydro-7-benzofurancarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
Methyl 4-amino-2,3-dihydro-1-benzofuran-7-carboxylate (CAS 1620412-64-7) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: methyl 4-amino-2,3-dihydro-1-benzofuran-7-carboxylate. InChIKey: RUYPYQPBSXIHHM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | methyl 4-amino-2,3-dihydro-1-benzofuran-7-carboxylate |
| InChIKey | RUYPYQPBSXIHHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=C(C=C1)N)CCO2 |
Computed by PubChem (NCBI)