CAS 16224-86-5 appears in our catalog under these names: 1,1-Dimethyl-3-oxo-1,3-dihydro-2-benzofuran-4-carboxylic acid, 95%, 1,1-Dimethyl-3-oxo-1,3-dihydro-2-benzofuran-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,025g, 0,05g, 0,1g, 0,25g, 0,5g.
1,1-dimethyl-3-oxo-2-benzofuran-4-carboxylic acid (CAS 16224-86-5) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 1,1-dimethyl-3-oxo-2-benzofuran-4-carboxylic acid. InChIKey: XQCLRXZPFMPKDQ-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1,1-dimethyl-3-oxo-2-benzofuran-4-carboxylic acid |
| InChIKey | XQCLRXZPFMPKDQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC(=C2C(=O)O1)C(=O)O)C |
Computed by PubChem (NCBI)