CAS 1622949-23-8 is the registry number for Ethyl 2-(3-methoxyphenyl)-5-methyloxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate (CAS 1622949-23-8) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: ethyl 2-(3-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: MQLNGYUSYTZEFG-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | ethyl 2-(3-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | MQLNGYUSYTZEFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC(=CC=C2)OC)C |
Computed by PubChem (NCBI)