CAS 1622987-63-6 is the registry number for Ethyl 3-bromo-4-(difluoromethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-bromo-4-(difluoromethyl)benzoate (CAS 1622987-63-6) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: ethyl 3-bromo-4-(difluoromethyl)benzoate. InChIKey: RTRJLUHKHGVOSX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O2 |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | ethyl 3-bromo-4-(difluoromethyl)benzoate |
| InChIKey | RTRJLUHKHGVOSX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C(F)F)Br |
Computed by PubChem (NCBI)