CAS 2227204-90-0 is the registry number for 3-(4-(Bromomethyl)-2,5-difluorophenyl)oxetan-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(bromomethyl)-2,5-difluorophenyl]oxetan-3-ol (CAS 2227204-90-0) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: 3-[4-(bromomethyl)-2,5-difluorophenyl]oxetan-3-ol. InChIKey: FCUJNPJYTXQBBE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O2 |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 3-[4-(bromomethyl)-2,5-difluorophenyl]oxetan-3-ol |
| InChIKey | FCUJNPJYTXQBBE-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=C(C=C(C(=C2)F)CBr)F)O |
Computed by PubChem (NCBI)