Products 2432848-57-0
CAS 2432848-57-0 appears in our catalog under these names: 2-(6-Bromo-2,4-difluoro-3-methylphenyl)-1,3-dioxolane, 95%, 2-(6-Bromo-2,4-difluoro-3-methylphenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(6-bromo-2,4-difluoro-3-methylphenyl)-1,3-dioxolane (CAS 2432848-57-0) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: 2-(6-bromo-2,4-difluoro-3-methylphenyl)-1,3-dioxolane. InChIKey: DLPXSAHJQFBWIA-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O2 |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 2-(6-bromo-2,4-difluoro-3-methylphenyl)-1,3-dioxolane |
| InChIKey | DLPXSAHJQFBWIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Br)C2OCCO2)F |
Computed by PubChem (NCBI)