CAS 2586126-30-7 appears in our catalog under these names: 5-Bromo-2,3-difluoro-4-isopropoxybenzaldehyde, 95%, 5-Bromo-2,3-difluoro-4-isopropoxybenzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
5-bromo-2,3-difluoro-4-propan-2-yloxybenzaldehyde (CAS 2586126-30-7) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-propan-2-yloxybenzaldehyde. InChIKey: KGXDMEDDWYDBTD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O2 |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-propan-2-yloxybenzaldehyde |
| InChIKey | KGXDMEDDWYDBTD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1F)F)C=O)Br |
Computed by PubChem (NCBI)