Products 2271058-85-4

CAS 2271058-85-4 is the registry number for 2,6-Dimethylphenyl 2-bromo-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

(2,6-dimethylphenyl) 2-bromo-2,2-difluoroacetate (CAS 2271058-85-4) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: (2,6-dimethylphenyl) 2-bromo-2,2-difluoroacetate. InChIKey: TYYFCQFCDBDESO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9BrF2O2
Molecular weight279.08 g/mol
IUPAC name(2,6-dimethylphenyl) 2-bromo-2,2-difluoroacetate
InChIKeyTYYFCQFCDBDESO-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)OC(=O)C(F)(F)Br

Computed by PubChem (NCBI)