CAS 2677883-91-7 is the registry number for 6-Bromo-4-(difluoromethyl)isochroman-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-(difluoromethyl)-1,3-dihydroisochromen-4-ol (CAS 2677883-91-7) is a chemical compound with the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. IUPAC name: 6-bromo-4-(difluoromethyl)-1,3-dihydroisochromen-4-ol. InChIKey: YDIQUNFSWGOPSI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O2 |
|---|---|
| Molecular weight | 279.08 g/mol |
| IUPAC name | 6-bromo-4-(difluoromethyl)-1,3-dihydroisochromen-4-ol |
| InChIKey | YDIQUNFSWGOPSI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Br)C(CO1)(C(F)F)O |
Computed by PubChem (NCBI)