Products 1623649-15-9
CAS 1623649-15-9 appears in our catalog under these names: 2-(2,6-Dichlorophenoxy)-N,N-dimethylacetamide, 2-(2,6-Dichlorophenoxy)-N,N-dimethylacetamide, 95%, 95%, 2-(2,6-Dichlorophenoxy)-N,N-dimethylacetamide, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 5g, 100mg, 1g.
2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide (CAS 1623649-15-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide. InChIKey: DRMPKCSMQVXTPP-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide |
| InChIKey | DRMPKCSMQVXTPP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)