CAS 162545-29-1 appears in our catalog under these names: 2-{Ethyl((9H-fluoren-9-ylmethoxy)carbonyl)amino}acetic acid, Fmoc-N-EtGly-OH 95%, 2-{Ethyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino}acetic acid, 98%, 98%, 2-{ethyl[(9h-fluoren-9-ylmethoxy)carbonyl]amino}acetic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 25g, 100mg, 50mg, 500mg.
2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 162545-29-1) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: JMRZSLGQRNZKJI-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | JMRZSLGQRNZKJI-UHFFFAOYSA-N |
| SMILES | CCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)