Products 162882-36-2
CAS 162882-36-2 is the registry number for 4-BENZYLOXY-ALPHA-CYANOCINNAMIC ACID, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (CAS 162882-36-2) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: (E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: YQASXVJGRZKXLK-XNTDXEJSSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | YQASXVJGRZKXLK-XNTDXEJSSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)