CAS 163105-64-4 is the registry number for SDH-IN-43. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-chlorophenyl)-1H-indole (CAS 163105-64-4) is a chemical compound with the molecular formula C14H10ClN and a molecular weight of 227.69 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-indole. InChIKey: WRCFPBZUXYWGPK-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-indole |
| InChIKey | WRCFPBZUXYWGPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(C=C2)NC=C3)Cl |
Computed by PubChem (NCBI)