CAS 16383-89-4 appears in our catalog under these names: 2-Ethoxy-4-nitroaniline, 95%, 4-nitro-o-phenetidine, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, 5g, on request.
2-ethoxy-4-nitroaniline (CAS 16383-89-4) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 2-ethoxy-4-nitroaniline. InChIKey: OWRHDQKCCXTFFE-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-ethoxy-4-nitroaniline |
| InChIKey | OWRHDQKCCXTFFE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)