Products 1639944-23-2
CAS 1639944-23-2 is the registry number for benzyl trans-4-amino-3-hydroxy-3-methyl-piperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Benzyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate (CAS 1639944-23-2) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: benzyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate. InChIKey: LDFHSGHZLOGTIE-JSGCOSHPSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | benzyl (3S,4S)-4-amino-3-hydroxy-3-methylpiperidine-1-carboxylate |
| InChIKey | LDFHSGHZLOGTIE-JSGCOSHPSA-N |
| SMILES | C[C@@]1(CN(CC[C@@H]1N)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)