Products 164525-14-8
CAS 164525-14-8 is the registry number for 2-Aminopyrido[2,3-d]pyrimidin-4(3H)-one Hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-3H-pyrido[2,3-d]pyrimidin-4-one;hydrochloride (CAS 164525-14-8) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: 2-amino-3H-pyrido[2,3-d]pyrimidin-4-one;hydrochloride. InChIKey: MSBQFTMFWCORFW-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | 2-amino-3H-pyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| InChIKey | MSBQFTMFWCORFW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(NC2=O)N.Cl |
Computed by PubChem (NCBI)