CAS 16459-44-2 is the registry number for 1-(4-Nitrophenyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-nitrophenyl)pyrazol-3-amine (CAS 16459-44-2) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-(4-nitrophenyl)pyrazol-3-amine. InChIKey: NORCOSFUIHPSGT-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-(4-nitrophenyl)pyrazol-3-amine |
| InChIKey | NORCOSFUIHPSGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=CC=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)