CAS 16498-20-7 appears in our catalog under these names: 6–Nitro–1,4–benzodioxane, 3,4-Ethylenedioxynitrobenzene, 6-Nitro-2,3-dihydrobenzo[b][1,4]dioxine 98%, 6-Nitro-2,3-dihydrobenzo[b][1,4]dioxine, 98%, 98%, 2,3-Dihydro-6-nitro-1,4-benzodioxin. Offered by: GLPBio, TCI, Ambeed, Chemat, HPC Standards. Available pack sizes: 1g, 25g, 5g, 100g, 1x250mg, 10g.
6-nitro-2,3-dihydro-1,4-benzodioxine (CAS 16498-20-7) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-nitro-2,3-dihydro-1,4-benzodioxine. InChIKey: MQSGCURTKWHBRX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-nitro-2,3-dihydro-1,4-benzodioxine |
| InChIKey | MQSGCURTKWHBRX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)