CAS 16505-75-2 is the registry number for 2-(3,4-Dichlorophenyl)-N-methylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-N-methylacetamide (CAS 16505-75-2) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-N-methylacetamide. InChIKey: CGFORRLIKRTSLT-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-N-methylacetamide |
| InChIKey | CGFORRLIKRTSLT-UHFFFAOYSA-N |
| SMILES | CNC(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)