CAS 16513-66-9 is the registry number for 1-(2-Hydroxy-indan-5-yl)-ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone (CAS 16513-66-9) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone. InChIKey: ANIOAWQPWXOTDL-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone |
| InChIKey | ANIOAWQPWXOTDL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(CC(C2)O)C=C1 |
Computed by PubChem (NCBI)