Products 165328-11-0
CAS 165328-11-0 is the registry number for 4,4-Difluoro-1-(4-methylphenyl)butane-1,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4,4-difluoro-1-(4-methylphenyl)butane-1,3-dione (CAS 165328-11-0) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 4,4-difluoro-1-(4-methylphenyl)butane-1,3-dione. InChIKey: JPMQITHKRYMPHA-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 4,4-difluoro-1-(4-methylphenyl)butane-1,3-dione |
| InChIKey | JPMQITHKRYMPHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(=O)C(F)F |
Computed by PubChem (NCBI)