Products 16533-45-2
CAS 16533-45-2 appears in our catalog under these names: 2–(Ethoxycarbonyl)–6–nitrobenzoic acid, 2-(Ethoxycarbonyl)-6-nitrobenzoic acid 97%, 2-(Ethoxycarbonyl)-6-nitrobenzoic acid 98+%, 2-(Ethoxycarbonyl)-6-nitrobenzoic acid, 98%, 2-(Ethoxycarbonyl)-6-nitrobenzoic acid, 98+%, 98+%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Chemat Brand. Available pack sizes: 100g, 500g, 250mg, 1g, 5g, 10g, 25g, 2.5kg.
2-ethoxycarbonyl-6-nitrobenzoic acid (CAS 16533-45-2) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 2-ethoxycarbonyl-6-nitrobenzoic acid. InChIKey: SZAOZGFHEAVFMM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 2-ethoxycarbonyl-6-nitrobenzoic acid |
| InChIKey | SZAOZGFHEAVFMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)